N-benzyl-4-methylpyridin-2-amine
Catalog No: FT-0718492
CAS No: 13021-71-1
- Chemical Name: N-benzyl-4-methylpyridin-2-amine
- Molecular Formula: C13H14N2
- Molecular Weight: 198.26
- InChI Key: QHDJYTUZWBABGW-UHFFFAOYSA-N
- InChI: InChI=1S/C13H14N2/c1-11-7-8-14-13(9-11)15-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,14,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 13021-71-1 |
| Flash_Point: | 161.1ºC |
| Product_Name: | 4-Picoline, 2-(benzylamino) |
| Bolling_Point: | 342.7ºC at 760mmHg |
| FW: | 198.26400 |
| Melting_Point: | N/A |
| MF: | C13H14N2 |
| Density: | 1.107g/cm3 |
| FW: | 198.26400 |
|---|---|
| Refractive_Index: | 1.624 |
| Vapor_Pressure: | 7.39E-05mmHg at 25°C |
| MF: | C13H14N2 |
| Exact_Mass: | 198.11600 |
| LogP: | 3.07510 |
| Bolling_Point: | 342.7ºC at 760mmHg |
| Density: | 1.107g/cm3 |
| PSA: | 24.92000 |
| Flash_Point: | 161.1ºC |
| Symbol: | GHS07 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)